CAS 915071-41-9 appears in our catalog under these names: 1-(3-Chloro-4-fluorophenyl)biguanide hydrochloride, 95%, 4-{({(Amino(imino)methyl)amino}(imino)methyl)amino}-2-chloro-1-fluorobenzene hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 25g, 5g, 1g, 0,25g, 2,5g.
2-(3-chloro-4-fluorophenyl)-1-(diaminomethylidene)guanidine;hydrochloride (CAS 915071-41-9) is a chemical compound with the molecular formula C8H10Cl2FN5 and a molecular weight of 266.10 g/mol. IUPAC name: 2-(3-chloro-4-fluorophenyl)-1-(diaminomethylidene)guanidine;hydrochloride. InChIKey: DLLQSZUCBVOQDX-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl2FN5 |
|---|---|
| Molecular weight | 266.10 g/mol |
| IUPAC name | 2-(3-chloro-4-fluorophenyl)-1-(diaminomethylidene)guanidine;hydrochloride |
| InChIKey | DLLQSZUCBVOQDX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N=C(N)N=C(N)N)Cl)F.Cl |
Computed by PubChem (NCBI)