Products 1030939-72-0
CAS 1030939-72-0 is the registry number for Methyl Valerimidate-d9 Hydrochloride. Offered by: TRC. Available pack sizes: 100mg, 10mg.
Methyl 2,2,3,3,4,4,5,5,5-nonadeuteriopentanimidate;hydrochloride (CAS 1030939-72-0) is a chemical compound with the molecular formula C6H14ClNO and a molecular weight of 160.69 g/mol. IUPAC name: methyl 2,2,3,3,4,4,5,5,5-nonadeuteriopentanimidate;hydrochloride. InChIKey: UAIVSGKSLHIONB-FWPXIMTBSA-N.
| Molecular formula | C6H14ClNO |
|---|---|
| Molecular weight | 160.69 g/mol |
| IUPAC name | methyl 2,2,3,3,4,4,5,5,5-nonadeuteriopentanimidate;hydrochloride |
| InChIKey | UAIVSGKSLHIONB-FWPXIMTBSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=N)OC.Cl |
Computed by PubChem (NCBI)