Products 1031064-47-7
CAS 1031064-47-7 is the registry number for N-(3-Bromo-4-methylphenyl)-3-(1H-1,2,3-triazol-1-yl)propanamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(3-bromo-4-methylphenyl)-3-(triazol-1-yl)propanamide (CAS 1031064-47-7) is a chemical compound with the molecular formula C12H13BrN4O and a molecular weight of 309.16 g/mol. IUPAC name: N-(3-bromo-4-methylphenyl)-3-(triazol-1-yl)propanamide. InChIKey: OFNBYYUNXRVMOO-UHFFFAOYSA-N.
| Molecular formula | C12H13BrN4O |
|---|---|
| Molecular weight | 309.16 g/mol |
| IUPAC name | N-(3-bromo-4-methylphenyl)-3-(triazol-1-yl)propanamide |
| InChIKey | OFNBYYUNXRVMOO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)CCN2C=CN=N2)Br |
Computed by PubChem (NCBI)