Products 949394-49-4
CAS 949394-49-4 is the registry number for N-(2-Bromo-4-methylphenyl)-3-(1H-1,2,4-triazol-1-yl)propanamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(2-bromo-4-methylphenyl)-3-(1,2,4-triazol-1-yl)propanamide (CAS 949394-49-4) is a chemical compound with the molecular formula C12H13BrN4O and a molecular weight of 309.16 g/mol. IUPAC name: N-(2-bromo-4-methylphenyl)-3-(1,2,4-triazol-1-yl)propanamide. InChIKey: QBMLTZJJQPEXIN-UHFFFAOYSA-N.
| Molecular formula | C12H13BrN4O |
|---|---|
| Molecular weight | 309.16 g/mol |
| IUPAC name | N-(2-bromo-4-methylphenyl)-3-(1,2,4-triazol-1-yl)propanamide |
| InChIKey | QBMLTZJJQPEXIN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)NC(=O)CCN2C=NC=N2)Br |
Computed by PubChem (NCBI)