CAS 1031195-19-3 appears in our catalog under these names: E1231, 95%, E1231/ 98.86% (existing batch purity), E1231, 1-{4-(2-(5-Methylfuran-2-yl)quinoline-4-carbonyl)piperazin-1-yl}ethan-1-one, 1-{4-[2-(5-methylfuran-2-yl)quinoline-4-carbonyl]piperazin-1-yl}ethan-1-one. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 5g, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg.
1-[4-[2-(5-methylfuran-2-yl)quinoline-4-carbonyl]piperazin-1-yl]ethanone (CAS 1031195-19-3) is a chemical compound with the molecular formula C21H21N3O3 and a molecular weight of 363.4 g/mol. IUPAC name: 1-[4-[2-(5-methylfuran-2-yl)quinoline-4-carbonyl]piperazin-1-yl]ethanone. InChIKey: ZQJTYRXKAZFWPK-UHFFFAOYSA-N.
| Molecular formula | C21H21N3O3 |
|---|---|
| Molecular weight | 363.4 g/mol |
| IUPAC name | 1-[4-[2-(5-methylfuran-2-yl)quinoline-4-carbonyl]piperazin-1-yl]ethanone |
| InChIKey | ZQJTYRXKAZFWPK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(O1)C2=NC3=CC=CC=C3C(=C2)C(=O)N4CCN(CC4)C(=O)C |
Computed by PubChem (NCBI)