CAS 193148-58-2 is the registry number for Fmoc-L-Val-CHN2. Offered by: Creative Peptides. Available pack sizes: 1g.
9H-fluoren-9-ylmethyl N-[(3S)-1-diazo-4-methyl-2-oxopentan-3-yl]carbamate (CAS 193148-58-2) is a chemical compound with the molecular formula C21H21N3O3 and a molecular weight of 363.4 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-[(3S)-1-diazo-4-methyl-2-oxopentan-3-yl]carbamate. InChIKey: BVQNUSIQJSEXIR-FQEVSTJZSA-N.
| Molecular formula | C21H21N3O3 |
|---|---|
| Molecular weight | 363.4 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-[(3S)-1-diazo-4-methyl-2-oxopentan-3-yl]carbamate |
| InChIKey | BVQNUSIQJSEXIR-FQEVSTJZSA-N |
| SMILES | CC(C)[C@@H](C(=O)C=[N+]=[N-])NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)