CAS 1031411-94-5 is the registry number for ACC1/2-IN-2, 99.00%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg, 50 mg, 25 mg.
6,7-dimethyl-1'-(7-methyl-1H-indazole-5-carbonyl)spiro[3H-chromene-2,4'-piperidine]-4-one (CAS 1031411-94-5) is a chemical compound with the molecular formula C24H25N3O3 and a molecular weight of 403.5 g/mol. IUPAC name: 6,7-dimethyl-1'-(7-methyl-1H-indazole-5-carbonyl)spiro[3H-chromene-2,4'-piperidine]-4-one. InChIKey: PQQBCUZITMWICX-UHFFFAOYSA-N.
| Molecular formula | C24H25N3O3 |
|---|---|
| Molecular weight | 403.5 g/mol |
| IUPAC name | 6,7-dimethyl-1'-(7-methyl-1H-indazole-5-carbonyl)spiro[3H-chromene-2,4'-piperidine]-4-one |
| InChIKey | PQQBCUZITMWICX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1NN=C2)C(=O)N3CCC4(CC3)CC(=O)C5=C(O4)C=C(C(=C5)C)C |
Computed by PubChem (NCBI)