Products 864685-20-1

CAS 864685-20-1 is the registry number for Benzyl (4-(4-(4-Hydroxyphenyl)piperazin-1-yl)phenyl)carbamate. Offered by: TRC, Biosynth. Available pack sizes: 5g, 10000mg, 5000mg.

Structural formula: {0} (CAS {1})

Benzyl N-[4-[4-(4-hydroxyphenyl)piperazin-1-yl]phenyl]carbamate (CAS 864685-20-1) is a chemical compound with the molecular formula C24H25N3O3 and a molecular weight of 403.5 g/mol. IUPAC name: benzyl N-[4-[4-(4-hydroxyphenyl)piperazin-1-yl]phenyl]carbamate. InChIKey: RZTHYBJKWVTDQD-UHFFFAOYSA-N.

Identity
Molecular formulaC24H25N3O3
Molecular weight403.5 g/mol
IUPAC namebenzyl N-[4-[4-(4-hydroxyphenyl)piperazin-1-yl]phenyl]carbamate
InChIKeyRZTHYBJKWVTDQD-UHFFFAOYSA-N
SMILESC1CN(CCN1C2=CC=C(C=C2)NC(=O)OCC3=CC=CC=C3)C4=CC=C(C=C4)O

Computed by PubChem (NCBI)