Products 1031555-77-7
CAS 1031555-77-7 is the registry number for 4-oxo-4H,7H-[1,2]oxazolo[5,4-d]pyrimidine-3-carboxylic acid, 98%. Offered by: Fluorochem. Available pack sizes: 1g.
4-oxo-5H-[1,2]oxazolo[5,4-d]pyrimidine-3-carboxylic acid (CAS 1031555-77-7) is a chemical compound with the molecular formula C6H3N3O4 and a molecular weight of 181.11 g/mol. IUPAC name: 4-oxo-5H-[1,2]oxazolo[5,4-d]pyrimidine-3-carboxylic acid. InChIKey: DOHDKSPIVKDPNW-UHFFFAOYSA-N.
| Molecular formula | C6H3N3O4 |
|---|---|
| Molecular weight | 181.11 g/mol |
| IUPAC name | 4-oxo-5H-[1,2]oxazolo[5,4-d]pyrimidine-3-carboxylic acid |
| InChIKey | DOHDKSPIVKDPNW-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(C(=NO2)C(=O)O)C(=O)N1 |
Computed by PubChem (NCBI)