CAS 1031702-80-3 appears in our catalog under these names: 4-(4-Acetyl-2-methoxy-5-nitrophenoxy)-butanoic acid ethyl ester, 95%, 4-(4-Acetyl-2-methoxy-5-nitrophenoxy)-butanoic Acid Ethyl Ester, >95% (HPLC), Ethyl 4-(4-acetyl-2-methoxy-5-nitrophenoxy)butanoate. Offered by: Combi-blocks, TRC, Biosynth. Available pack sizes: 5g, 250mg, 1g, 500mg, 5000mg, 1000mg.
Ethyl 4-(4-acetyl-2-methoxy-5-nitrophenoxy)butanoate (CAS 1031702-80-3) is a chemical compound with the molecular formula C15H19NO7 and a molecular weight of 325.31 g/mol. IUPAC name: ethyl 4-(4-acetyl-2-methoxy-5-nitrophenoxy)butanoate. InChIKey: QFBXDFLAZPHMAN-UHFFFAOYSA-N.
| Molecular formula | C15H19NO7 |
|---|---|
| Molecular weight | 325.31 g/mol |
| IUPAC name | ethyl 4-(4-acetyl-2-methoxy-5-nitrophenoxy)butanoate |
| InChIKey | QFBXDFLAZPHMAN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCCOC1=C(C=C(C(=C1)[N+](=O)[O-])C(=O)C)OC |
Computed by PubChem (NCBI)