CAS 152647-43-3 is the registry number for Dimethyl (2S,4S)-2-(((benzyloxy)carbonyl)amino)-4-hydroxypentanedioate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Dimethyl (2S,4S)-2-hydroxy-4-(phenylmethoxycarbonylamino)pentanedioate (CAS 152647-43-3) is a chemical compound with the molecular formula C15H19NO7 and a molecular weight of 325.31 g/mol. IUPAC name: dimethyl (2S,4S)-2-hydroxy-4-(phenylmethoxycarbonylamino)pentanedioate. InChIKey: WKGTXWFVXZEFBE-RYUDHWBXSA-N.
| Molecular formula | C15H19NO7 |
|---|---|
| Molecular weight | 325.31 g/mol |
| IUPAC name | dimethyl (2S,4S)-2-hydroxy-4-(phenylmethoxycarbonylamino)pentanedioate |
| InChIKey | WKGTXWFVXZEFBE-RYUDHWBXSA-N |
| SMILES | COC(=O)[C@H](C[C@@H](C(=O)OC)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)