Products 1031977-09-9

CAS 1031977-09-9 is the registry number for 1-(4-Methoxyphenyl)-5-(pyridin-3-yl)-1h-1,2,3-triazole-4-carboxylic acid, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

1-(4-methoxyphenyl)-5-pyridin-3-yltriazole-4-carboxylic acid (CAS 1031977-09-9) is a chemical compound with the molecular formula C15H12N4O3 and a molecular weight of 296.28 g/mol. IUPAC name: 1-(4-methoxyphenyl)-5-pyridin-3-yltriazole-4-carboxylic acid. InChIKey: QNZFUZAOBNYSEM-UHFFFAOYSA-N.

Identity
Molecular formulaC15H12N4O3
Molecular weight296.28 g/mol
IUPAC name1-(4-methoxyphenyl)-5-pyridin-3-yltriazole-4-carboxylic acid
InChIKeyQNZFUZAOBNYSEM-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)N2C(=C(N=N2)C(=O)O)C3=CN=CC=C3

Computed by PubChem (NCBI)