CAS 112146-96-0 is the registry number for N-((5-Nitro-1H-benzimidazole-2-yl)methyl)benzamide. Offered by: TRC. Available pack sizes: 500mg.
N-[(6-nitro-1H-benzimidazol-2-yl)methyl]benzamide (CAS 112146-96-0) is a chemical compound with the molecular formula C15H12N4O3 and a molecular weight of 296.28 g/mol. IUPAC name: N-[(6-nitro-1H-benzimidazol-2-yl)methyl]benzamide. InChIKey: HHNILPINEFLVBV-UHFFFAOYSA-N.
| Molecular formula | C15H12N4O3 |
|---|---|
| Molecular weight | 296.28 g/mol |
| IUPAC name | N-[(6-nitro-1H-benzimidazol-2-yl)methyl]benzamide |
| InChIKey | HHNILPINEFLVBV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NCC2=NC3=C(N2)C=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)