Products 103204-07-5
CAS 103204-07-5 appears in our catalog under these names: 4-Iodo-3-methylbenzoic acid ethyl ester, 95%, Ethyl 4–iodo–3–methylbenzoate, Ethyl 4-iodo-3-methylbenzoate. Offered by: Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g.
Ethyl 4-iodo-3-methylbenzoate (CAS 103204-07-5) is a chemical compound with the molecular formula C10H11IO2 and a molecular weight of 290.10 g/mol. IUPAC name: ethyl 4-iodo-3-methylbenzoate. InChIKey: POCCTDZBWSWSQQ-UHFFFAOYSA-N.
| Molecular formula | C10H11IO2 |
|---|---|
| Molecular weight | 290.10 g/mol |
| IUPAC name | ethyl 4-iodo-3-methylbenzoate |
| InChIKey | POCCTDZBWSWSQQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)I)C |
Computed by PubChem (NCBI)