CAS 933585-44-5 appears in our catalog under these names: Ethyl 2–iodo–5–methylbenzoate, ETHYL 2-IODO-5-METHYLBENZOATE, Ethyl 2-iodo-5-methylbenzoate, 95%, Ethyl 2-iodo-5-methylbenzoate, ≥95%, ≥95%. Offered by: GLPBio, Fluorochem, Combi-blocks, Chemat. Available pack sizes: 10g, 1g, 5g, 250mg, 25g.
Ethyl 2-iodo-5-methylbenzoate (CAS 933585-44-5) is a chemical compound with the molecular formula C10H11IO2 and a molecular weight of 290.10 g/mol. IUPAC name: ethyl 2-iodo-5-methylbenzoate. InChIKey: SVWOPCVCIDLBEY-UHFFFAOYSA-N.
| Molecular formula | C10H11IO2 |
|---|---|
| Molecular weight | 290.10 g/mol |
| IUPAC name | ethyl 2-iodo-5-methylbenzoate |
| InChIKey | SVWOPCVCIDLBEY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1)C)I |
Computed by PubChem (NCBI)