CAS 103213-31-6 appears in our catalog under these names: Fmoc–Tyr(3,5–I2)–OH, Fmoc-L-Tyr(3,5-I2)-OH, Fmoc-Tyr(3,5-DiI)-OH 98%, N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-3,5-diiodo-L-tyrosine, 97%, 97%, Fmoc-Tyr(3,5-I2)-OH, 99.98%. Offered by: GLPBio, Iris Biotech, Ambeed, Chemat, MedChemExpress. Available pack sizes: 10g, 25g, 5g, 1g, 250mg, 5 g, 25 g, 10 g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid (CAS 103213-31-6) is a chemical compound with the molecular formula C24H19I2NO5 and a molecular weight of 655.2 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid. InChIKey: IKNWCIROCRMKAY-NRFANRHFSA-N.
| Molecular formula | C24H19I2NO5 |
|---|---|
| Molecular weight | 655.2 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid |
| InChIKey | IKNWCIROCRMKAY-NRFANRHFSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CC(=C(C(=C4)I)O)I)C(=O)O |
Computed by PubChem (NCBI)