CAS 212651-51-9 appears in our catalog under these names: Fmoc-3,5-diiodo-d-tyrosine, 97%, Fmoc-3,5-diiodo-D-tyrosine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 25g, 5g, 2g.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid (CAS 212651-51-9) is a chemical compound with the molecular formula C24H19I2NO5 and a molecular weight of 655.2 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid. InChIKey: IKNWCIROCRMKAY-OAQYLSRUSA-N.
| Molecular formula | C24H19I2NO5 |
|---|---|
| Molecular weight | 655.2 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid |
| InChIKey | IKNWCIROCRMKAY-OAQYLSRUSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CC4=CC(=C(C(=C4)I)O)I)C(=O)O |
Computed by PubChem (NCBI)