CAS 1032231-19-8 appears in our catalog under these names: (2,5-Dibromophenyl)trimethylsilane, 97%, (2,5-Dibromophenyl)trimethylsilane, 98%, 1,4-Dibromo-2-(trimethylsilyl)benzene. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 10g, 25g, 100g, 5g, 1g.
(2,5-dibromophenyl)-trimethylsilane (CAS 1032231-19-8) is a chemical compound with the molecular formula C9H12Br2Si and a molecular weight of 308.08 g/mol. IUPAC name: (2,5-dibromophenyl)-trimethylsilane. InChIKey: AHBFBOAMDRJUEO-UHFFFAOYSA-N.
| Molecular formula | C9H12Br2Si |
|---|---|
| Molecular weight | 308.08 g/mol |
| IUPAC name | (2,5-dibromophenyl)-trimethylsilane |
| InChIKey | AHBFBOAMDRJUEO-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1=C(C=CC(=C1)Br)Br |
Computed by PubChem (NCBI)