CAS 363598-42-9 appears in our catalog under these names: 1,3-Dibromo-2-(trimethylsilyl)-benzene, 97%, 1,3–dibromo–2–(trimethylsilyl)benzene, 1,3-Dibromo-2-(trimethylsilyl)benzene, 97%, 97%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 5g, 1g, 250mg.
(2,6-dibromophenyl)-trimethylsilane (CAS 363598-42-9) is a chemical compound with the molecular formula C9H12Br2Si and a molecular weight of 308.08 g/mol. IUPAC name: (2,6-dibromophenyl)-trimethylsilane. InChIKey: FDYHYDJCDYVQNB-UHFFFAOYSA-N.
| Molecular formula | C9H12Br2Si |
|---|---|
| Molecular weight | 308.08 g/mol |
| IUPAC name | (2,6-dibromophenyl)-trimethylsilane |
| InChIKey | FDYHYDJCDYVQNB-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1=C(C=CC=C1Br)Br |
Computed by PubChem (NCBI)