CAS 1032506-93-6 appears in our catalog under these names: 1-Fluoro-4-phenyl-2-(trifluoromethyl)benzene, 98%, 4-Fluoro-3-(trifluoromethyl)-1,1'-biphenyl, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 1g.
1-fluoro-4-phenyl-2-(trifluoromethyl)benzene (CAS 1032506-93-6) is a chemical compound with the molecular formula C13H8F4 and a molecular weight of 240.20 g/mol. IUPAC name: 1-fluoro-4-phenyl-2-(trifluoromethyl)benzene. InChIKey: FGWNYRVOPRAMRX-UHFFFAOYSA-N.
| Molecular formula | C13H8F4 |
|---|---|
| Molecular weight | 240.20 g/mol |
| IUPAC name | 1-fluoro-4-phenyl-2-(trifluoromethyl)benzene |
| InChIKey | FGWNYRVOPRAMRX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C=C2)F)C(F)(F)F |
Computed by PubChem (NCBI)