Products 59079-87-7
CAS 59079-87-7 is the registry number for 4-Fluoro-4'-(trifluoromethyl)-1,1'-biphenyl, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
1-fluoro-4-[4-(trifluoromethyl)phenyl]benzene (CAS 59079-87-7) is a chemical compound with the molecular formula C13H8F4 and a molecular weight of 240.20 g/mol. IUPAC name: 1-fluoro-4-[4-(trifluoromethyl)phenyl]benzene. InChIKey: VBYPCJIAVPFBDO-UHFFFAOYSA-N.
| Molecular formula | C13H8F4 |
|---|---|
| Molecular weight | 240.20 g/mol |
| IUPAC name | 1-fluoro-4-[4-(trifluoromethyl)phenyl]benzene |
| InChIKey | VBYPCJIAVPFBDO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)F)C(F)(F)F |
Computed by PubChem (NCBI)