Products 1032715-49-3

CAS 1032715-49-3 is the registry number for 5-Bromo-1-(cyanomethyl)-1H-indole-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

5-bromo-1-(cyanomethyl)indole-2-carboxylic acid (CAS 1032715-49-3) is a chemical compound with the molecular formula C11H7BrN2O2 and a molecular weight of 279.09 g/mol. IUPAC name: 5-bromo-1-(cyanomethyl)indole-2-carboxylic acid. InChIKey: SYYRSQYFVRJYCE-UHFFFAOYSA-N.

Identity
Molecular formulaC11H7BrN2O2
Molecular weight279.09 g/mol
IUPAC name5-bromo-1-(cyanomethyl)indole-2-carboxylic acid
InChIKeySYYRSQYFVRJYCE-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C1Br)C=C(N2CC#N)C(=O)O

Computed by PubChem (NCBI)