Products 1092300-70-3

CAS 1092300-70-3 is the registry number for 2-(4-Bromophenyl)pyrimidine-4-carboxylic acid 95%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg.

Structural formula: {0} (CAS {1})

2-(4-bromophenyl)pyrimidine-4-carboxylic acid (CAS 1092300-70-3) is a chemical compound with the molecular formula C11H7BrN2O2 and a molecular weight of 279.09 g/mol. IUPAC name: 2-(4-bromophenyl)pyrimidine-4-carboxylic acid. InChIKey: WWUHOVWNNQTJMP-UHFFFAOYSA-N.

Identity
Molecular formulaC11H7BrN2O2
Molecular weight279.09 g/mol
IUPAC name2-(4-bromophenyl)pyrimidine-4-carboxylic acid
InChIKeyWWUHOVWNNQTJMP-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C2=NC=CC(=N2)C(=O)O)Br

Computed by PubChem (NCBI)