Products 103274-15-3
CAS 103274-15-3 is the registry number for 5-(3-Aminophenyl)-5-methylimidazolidine-2,4-dione. Offered by: Biosynth. Available pack sizes: 0,25g, 0,1g, 0,5g, 1g, 2g.
5-(3-aminophenyl)-5-methylimidazolidine-2,4-dione (CAS 103274-15-3) is a chemical compound with the molecular formula C10H11N3O2 and a molecular weight of 205.21 g/mol. IUPAC name: 5-(3-aminophenyl)-5-methylimidazolidine-2,4-dione. InChIKey: JJFIISOFQBYREX-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O2 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | 5-(3-aminophenyl)-5-methylimidazolidine-2,4-dione |
| InChIKey | JJFIISOFQBYREX-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)NC(=O)N1)C2=CC(=CC=C2)N |
Computed by PubChem (NCBI)