CAS 10329-81-4 is the registry number for D-Aspartic acid sodium salt. Offered by: Biosynth. Available pack sizes: 5000g, 2000g, 10000g, 25000g.
Sodium (2R)-2-amino-4-hydroxy-4-oxobutanoate (CAS 10329-81-4) is a chemical compound with the molecular formula C4H6NNaO4 and a molecular weight of 155.08 g/mol. IUPAC name: sodium (2R)-2-amino-4-hydroxy-4-oxobutanoate. InChIKey: WTWSHHITWMVLBX-HSHFZTNMSA-M.
| Molecular formula | C4H6NNaO4 |
|---|---|
| Molecular weight | 155.08 g/mol |
| IUPAC name | sodium (2R)-2-amino-4-hydroxy-4-oxobutanoate |
| InChIKey | WTWSHHITWMVLBX-HSHFZTNMSA-M |
| SMILES | C([C@H](C(=O)[O-])N)C(=O)O.[Na+] |
Computed by PubChem (NCBI)