CAS 103290-07-9 is the registry number for Carbamic acid, [1-[[(2,5-dioxo-1-pyrrolidinyl)oxy]carbonyl]propyl]-, 1,1-dimethylethyl ester, (s)-, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
(2,5-dioxopyrrolidin-1-yl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (CAS 103290-07-9) is a chemical compound with the molecular formula C13H20N2O6 and a molecular weight of 300.31 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate. InChIKey: HLTFLYMXIANSTL-QMMMGPOBSA-N.
| Molecular formula | C13H20N2O6 |
|---|---|
| Molecular weight | 300.31 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| InChIKey | HLTFLYMXIANSTL-QMMMGPOBSA-N |
| SMILES | CC[C@@H](C(=O)ON1C(=O)CCC1=O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)