Products 1105187-49-2

CAS 1105187-49-2 is the registry number for 1-(2,2-Diethoxyethyl)-5-nitro-1h-pyrrole-2-carboxylic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 1-(2,2-diethoxyethyl)-5-nitropyrrole-2-carboxylate (CAS 1105187-49-2) is a chemical compound with the molecular formula C13H20N2O6 and a molecular weight of 300.31 g/mol. IUPAC name: ethyl 1-(2,2-diethoxyethyl)-5-nitropyrrole-2-carboxylate. InChIKey: WGXFNSFTGHOHPU-UHFFFAOYSA-N.

Identity
Molecular formulaC13H20N2O6
Molecular weight300.31 g/mol
IUPAC nameethyl 1-(2,2-diethoxyethyl)-5-nitropyrrole-2-carboxylate
InChIKeyWGXFNSFTGHOHPU-UHFFFAOYSA-N
SMILESCCOC(CN1C(=CC=C1[N+](=O)[O-])C(=O)OCC)OCC

Computed by PubChem (NCBI)