CAS 1105187-49-2 is the registry number for 1-(2,2-Diethoxyethyl)-5-nitro-1h-pyrrole-2-carboxylic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Ethyl 1-(2,2-diethoxyethyl)-5-nitropyrrole-2-carboxylate (CAS 1105187-49-2) is a chemical compound with the molecular formula C13H20N2O6 and a molecular weight of 300.31 g/mol. IUPAC name: ethyl 1-(2,2-diethoxyethyl)-5-nitropyrrole-2-carboxylate. InChIKey: WGXFNSFTGHOHPU-UHFFFAOYSA-N.
| Molecular formula | C13H20N2O6 |
|---|---|
| Molecular weight | 300.31 g/mol |
| IUPAC name | ethyl 1-(2,2-diethoxyethyl)-5-nitropyrrole-2-carboxylate |
| InChIKey | WGXFNSFTGHOHPU-UHFFFAOYSA-N |
| SMILES | CCOC(CN1C(=CC=C1[N+](=O)[O-])C(=O)OCC)OCC |
Computed by PubChem (NCBI)