CAS 103296-32-8 appears in our catalog under these names: Cefepime Impurity E, Cefepime EP Impurity E, NMP-ACA (cefepime impurity). Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 500mg, 250mg, 1000mg, 5000mg, 2000mg.
(6R,7R)-7-amino-3-[(1-methylpyrrolidin-1-ium-1-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (CAS 103296-32-8) is a chemical compound with the molecular formula C13H19N3O3S and a molecular weight of 297.38 g/mol. IUPAC name: (6R,7R)-7-amino-3-[(1-methylpyrrolidin-1-ium-1-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate. InChIKey: IIVPIDBZUUAWTF-BXKDBHETSA-N.
| Molecular formula | C13H19N3O3S |
|---|---|
| Molecular weight | 297.38 g/mol |
| IUPAC name | (6R,7R)-7-amino-3-[(1-methylpyrrolidin-1-ium-1-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| InChIKey | IIVPIDBZUUAWTF-BXKDBHETSA-N |
| SMILES | C[N+]1(CCCC1)CC2=C(N3[C@@H]([C@@H](C3=O)N)SC2)C(=O)[O-] |
Computed by PubChem (NCBI)