Products 312286-45-6
CAS 312286-45-6 is the registry number for 1-(4-Methylbenzenesulfonyl)piperidine-3-carbohydrazide. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
1-(4-methylphenyl)sulfonylpiperidine-3-carbohydrazide (CAS 312286-45-6) is a chemical compound with the molecular formula C13H19N3O3S and a molecular weight of 297.38 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonylpiperidine-3-carbohydrazide. InChIKey: PNRINHNJRRGYLP-UHFFFAOYSA-N.
| Molecular formula | C13H19N3O3S |
|---|---|
| Molecular weight | 297.38 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonylpiperidine-3-carbohydrazide |
| InChIKey | PNRINHNJRRGYLP-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CCCC(C2)C(=O)NN |
Computed by PubChem (NCBI)