CAS 1033048-17-7 appears in our catalog under these names: 1-(3,5-Dimethoxyphenyl)cyclopropane-1-carboxylic acid, 98%, 1-(3,5-Dimethoxyphenyl)cyclopropanecarboxylic acid, 1-(3,5-Dimethoxyphenyl)cyclopropane-1-carboxylic acid, 98%, 98%, 1-(3,5-DIMETHOXYPHENYL)CYCLOPROPANECARBOXYLIC ACID, 98%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 0,5g, 50mg, 100mg, 250mg.
1-(3,5-dimethoxyphenyl)cyclopropane-1-carboxylic acid (CAS 1033048-17-7) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. IUPAC name: 1-(3,5-dimethoxyphenyl)cyclopropane-1-carboxylic acid. InChIKey: GHYRJDAVVAXCHC-UHFFFAOYSA-N.
| Molecular formula | C12H14O4 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 1-(3,5-dimethoxyphenyl)cyclopropane-1-carboxylic acid |
| InChIKey | GHYRJDAVVAXCHC-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)C2(CC2)C(=O)O)OC |
Computed by PubChem (NCBI)