CAS 1033194-56-7 is the registry number for Benzyl 4-bromo-2-hydroxybenzylcarbamate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
Benzyl N-[(4-bromo-2-hydroxyphenyl)methyl]carbamate (CAS 1033194-56-7) is a chemical compound with the molecular formula C15H14BrNO3 and a molecular weight of 336.18 g/mol. IUPAC name: benzyl N-[(4-bromo-2-hydroxyphenyl)methyl]carbamate. InChIKey: WCYLRGVFURSSRN-UHFFFAOYSA-N.
| Molecular formula | C15H14BrNO3 |
|---|---|
| Molecular weight | 336.18 g/mol |
| IUPAC name | benzyl N-[(4-bromo-2-hydroxyphenyl)methyl]carbamate |
| InChIKey | WCYLRGVFURSSRN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NCC2=C(C=C(C=C2)Br)O |
Computed by PubChem (NCBI)