CAS 2288708-76-7 is the registry number for 3-Bromo-5-[(4-methoxyphenyl)methoxy]benzamide, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-bromo-5-[(4-methoxyphenyl)methoxy]benzamide (CAS 2288708-76-7) is a chemical compound with the molecular formula C15H14BrNO3 and a molecular weight of 336.18 g/mol. IUPAC name: 3-bromo-5-[(4-methoxyphenyl)methoxy]benzamide. InChIKey: XRXJUZOTCNRZCL-UHFFFAOYSA-N.
| Molecular formula | C15H14BrNO3 |
|---|---|
| Molecular weight | 336.18 g/mol |
| IUPAC name | 3-bromo-5-[(4-methoxyphenyl)methoxy]benzamide |
| InChIKey | XRXJUZOTCNRZCL-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)COC2=CC(=CC(=C2)C(=O)N)Br |
Computed by PubChem (NCBI)