CAS 1033201-53-4 is the registry number for N-(2-(4-Nitrophenoxy)ethyl)cyclopropanamine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 100g, 500g, 5g, 1g.
N-[2-(4-nitrophenoxy)ethyl]cyclopropanamine (CAS 1033201-53-4) is a chemical compound with the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. IUPAC name: N-[2-(4-nitrophenoxy)ethyl]cyclopropanamine. InChIKey: OLWUWJKKLWGYFD-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O3 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | N-[2-(4-nitrophenoxy)ethyl]cyclopropanamine |
| InChIKey | OLWUWJKKLWGYFD-UHFFFAOYSA-N |
| SMILES | C1CC1NCCOC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)