CAS 1033201-89-6 is the registry number for 1-(3-Chloro-4-fluorophenyl)piperidine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 1g, 100g, 5g.
1-(3-chloro-4-fluorophenyl)piperidine (CAS 1033201-89-6) is a chemical compound with the molecular formula C11H13ClFN and a molecular weight of 213.68 g/mol. IUPAC name: 1-(3-chloro-4-fluorophenyl)piperidine. InChIKey: FOWVTJMHLJVBHP-UHFFFAOYSA-N.
| Molecular formula | C11H13ClFN |
|---|---|
| Molecular weight | 213.68 g/mol |
| IUPAC name | 1-(3-chloro-4-fluorophenyl)piperidine |
| InChIKey | FOWVTJMHLJVBHP-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C2=CC(=C(C=C2)F)Cl |
Computed by PubChem (NCBI)