Products 2731007-31-9
CAS 2731007-31-9 appears in our catalog under these names: 2-Fluoro-3-phenylbicyclo[1.1.1]pentan-1-amine hydrochloride, 98%, 2-Fluoro-3-phenylbicyclo[1.1.1]pentan-1-amine Hydrochloride, >97%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g.
2-fluoro-3-phenylbicyclo[1.1.1]pentan-1-amine;hydrochloride (CAS 2731007-31-9) is a chemical compound with the molecular formula C11H13ClFN and a molecular weight of 213.68 g/mol. IUPAC name: 2-fluoro-3-phenylbicyclo[1.1.1]pentan-1-amine;hydrochloride. InChIKey: YUUXXTLAGZVVBK-UHFFFAOYSA-N.
| Molecular formula | C11H13ClFN |
|---|---|
| Molecular weight | 213.68 g/mol |
| IUPAC name | 2-fluoro-3-phenylbicyclo[1.1.1]pentan-1-amine;hydrochloride |
| InChIKey | YUUXXTLAGZVVBK-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(C2F)N)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)