Products 1033202-00-4
CAS 1033202-00-4 is the registry number for 3-(4-Nitrophenyl)-5-(prop-1-en-2-yl)-1,2,4-oxadiazole, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-(4-nitrophenyl)-5-prop-1-en-2-yl-1,2,4-oxadiazole (CAS 1033202-00-4) is a chemical compound with the molecular formula C11H9N3O3 and a molecular weight of 231.21 g/mol. IUPAC name: 3-(4-nitrophenyl)-5-prop-1-en-2-yl-1,2,4-oxadiazole. InChIKey: HJCLGFFHDOBJDR-UHFFFAOYSA-N.
| Molecular formula | C11H9N3O3 |
|---|---|
| Molecular weight | 231.21 g/mol |
| IUPAC name | 3-(4-nitrophenyl)-5-prop-1-en-2-yl-1,2,4-oxadiazole |
| InChIKey | HJCLGFFHDOBJDR-UHFFFAOYSA-N |
| SMILES | CC(=C)C1=NC(=NO1)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)