CAS 17952-86-2 is the registry number for 6-Nitro-2,3,4,4a,9,9a-hexahydro-1H-pyrido[3,4-b]indol-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-nitro-2,3,4,9-tetrahydropyrido[3,4-b]indol-1-one (CAS 17952-86-2) is a chemical compound with the molecular formula C11H9N3O3 and a molecular weight of 231.21 g/mol. IUPAC name: 6-nitro-2,3,4,9-tetrahydropyrido[3,4-b]indol-1-one. InChIKey: OGWVNBMJFPRUIP-UHFFFAOYSA-N.
| Molecular formula | C11H9N3O3 |
|---|---|
| Molecular weight | 231.21 g/mol |
| IUPAC name | 6-nitro-2,3,4,9-tetrahydropyrido[3,4-b]indol-1-one |
| InChIKey | OGWVNBMJFPRUIP-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)C2=C1C3=C(N2)C=CC(=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)