CAS 1033202-32-2 is the registry number for 2-(5-Bromo-3-nitropyridin-2-ylamino)ethanol, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
2-[(5-bromo-3-nitro-2-pyridinyl)amino]ethanol (CAS 1033202-32-2) is a chemical compound with the molecular formula C7H8BrN3O3 and a molecular weight of 262.06 g/mol. IUPAC name: 2-[(5-bromo-3-nitro-2-pyridinyl)amino]ethanol. InChIKey: MPSIEXNQZJDIOU-UHFFFAOYSA-N.
| Molecular formula | C7H8BrN3O3 |
|---|---|
| Molecular weight | 262.06 g/mol |
| IUPAC name | 2-[(5-bromo-3-nitro-2-pyridinyl)amino]ethanol |
| InChIKey | MPSIEXNQZJDIOU-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1[N+](=O)[O-])NCCO)Br |
Computed by PubChem (NCBI)