Products 1340409-03-1
CAS 1340409-03-1 is the registry number for 4-Bromo-3-nitro-1-(tetrahydrofuran-3-yl)-1H-pyrazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-3-nitro-1-(oxolan-3-yl)pyrazole (CAS 1340409-03-1) is a chemical compound with the molecular formula C7H8BrN3O3 and a molecular weight of 262.06 g/mol. IUPAC name: 4-bromo-3-nitro-1-(oxolan-3-yl)pyrazole. InChIKey: SGRYJDUBTYMMDD-UHFFFAOYSA-N.
| Molecular formula | C7H8BrN3O3 |
|---|---|
| Molecular weight | 262.06 g/mol |
| IUPAC name | 4-bromo-3-nitro-1-(oxolan-3-yl)pyrazole |
| InChIKey | SGRYJDUBTYMMDD-UHFFFAOYSA-N |
| SMILES | C1COCC1N2C=C(C(=N2)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)