CAS 1033227-40-5 appears in our catalog under these names: 1-N-(2,4-Difluorophenyl)benzene-1,2-diamine, 95%, 1-N-(2,4-Difluorophenyl)benzene-1,2-diamine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2-N-(2,4-difluorophenyl)benzene-1,2-diamine (CAS 1033227-40-5) is a chemical compound with the molecular formula C12H10F2N2 and a molecular weight of 220.22 g/mol. IUPAC name: 2-N-(2,4-difluorophenyl)benzene-1,2-diamine. InChIKey: BGBSSHMFWJXZOZ-UHFFFAOYSA-N.
| Molecular formula | C12H10F2N2 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | 2-N-(2,4-difluorophenyl)benzene-1,2-diamine |
| InChIKey | BGBSSHMFWJXZOZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)NC2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)