CAS 103361-67-7 is the registry number for 7-Fluoro-6-nitro-2h-1,4-benzoxazin-3(4h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
7-fluoro-6-nitro-4H-1,4-benzoxazin-3-one (CAS 103361-67-7) is a chemical compound with the molecular formula C8H5FN2O4 and a molecular weight of 212.13 g/mol. IUPAC name: 7-fluoro-6-nitro-4H-1,4-benzoxazin-3-one. InChIKey: MNUBUFBVOBPANC-UHFFFAOYSA-N.
| Molecular formula | C8H5FN2O4 |
|---|---|
| Molecular weight | 212.13 g/mol |
| IUPAC name | 7-fluoro-6-nitro-4H-1,4-benzoxazin-3-one |
| InChIKey | MNUBUFBVOBPANC-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=CC(=C(C=C2O1)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)