CAS 1160591-69-4 is the registry number for 6-Fluoro-7-nitro-3,4-dihydro-2H-1,4-benzoxazin-3-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-fluoro-7-nitro-4H-1,4-benzoxazin-3-one (CAS 1160591-69-4) is a chemical compound with the molecular formula C8H5FN2O4 and a molecular weight of 212.13 g/mol. IUPAC name: 6-fluoro-7-nitro-4H-1,4-benzoxazin-3-one. InChIKey: STDKYNXGCODEDD-UHFFFAOYSA-N.
| Molecular formula | C8H5FN2O4 |
|---|---|
| Molecular weight | 212.13 g/mol |
| IUPAC name | 6-fluoro-7-nitro-4H-1,4-benzoxazin-3-one |
| InChIKey | STDKYNXGCODEDD-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=CC(=C(C=C2O1)[N+](=O)[O-])F |
Computed by PubChem (NCBI)