Products 10338-88-2
CAS 10338-88-2 appears in our catalog under these names: Pyroside, β-D-Glucopyranoside, 4-hydroxyphenyl, 6-acetate, ≥95%. Offered by: MedChemExpress, Chemat. Available pack sizes: Get quote, 5mg.
[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(4-hydroxyphenoxy)oxan-2-yl]methyl acetate (CAS 10338-88-2) is a chemical compound with the molecular formula C14H18O8 and a molecular weight of 314.29 g/mol. IUPAC name: [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(4-hydroxyphenoxy)oxan-2-yl]methyl acetate. InChIKey: XABUTYXAHYMCDK-RKQHYHRCSA-N.
| Molecular formula | C14H18O8 |
|---|---|
| Molecular weight | 314.29 g/mol |
| IUPAC name | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(4-hydroxyphenoxy)oxan-2-yl]methyl acetate |
| InChIKey | XABUTYXAHYMCDK-RKQHYHRCSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)OC2=CC=C(C=C2)O)O)O)O |
Computed by PubChem (NCBI)