Products 25348-63-4
CAS 25348-63-4 is the registry number for Conduritol B Tetraacetate. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 250mg, 50mg, 250 mg, 25 mg, 50 mg, 100 mg.
[(1S,4S,5R,6R)-4,5,6-triacetyloxycyclohex-2-en-1-yl] acetate (CAS 25348-63-4) is a chemical compound with the molecular formula C14H18O8 and a molecular weight of 314.29 g/mol. IUPAC name: [(1S,4S,5R,6R)-4,5,6-triacetyloxycyclohex-2-en-1-yl] acetate. InChIKey: REXNPDYWUANMIX-IGQOVBAYSA-N.
| Molecular formula | C14H18O8 |
|---|---|
| Molecular weight | 314.29 g/mol |
| IUPAC name | [(1S,4S,5R,6R)-4,5,6-triacetyloxycyclohex-2-en-1-yl] acetate |
| InChIKey | REXNPDYWUANMIX-IGQOVBAYSA-N |
| SMILES | CC(=O)O[C@H]1C=C[C@@H]([C@H]([C@@H]1OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)