CAS 1033850-69-9 is the registry number for 1-(2-Methyl-5-nitro-1H-imidazol-4-yl)piperazine hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2-methyl-5-nitro-1H-imidazol-4-yl)piperazine (CAS 1033850-69-9) is a chemical compound with the molecular formula C8H13N5O2 and a molecular weight of 211.22 g/mol. IUPAC name: 1-(2-methyl-5-nitro-1H-imidazol-4-yl)piperazine. InChIKey: XSNZSKAAABDXFA-UHFFFAOYSA-N.
| Molecular formula | C8H13N5O2 |
|---|---|
| Molecular weight | 211.22 g/mol |
| IUPAC name | 1-(2-methyl-5-nitro-1H-imidazol-4-yl)piperazine |
| InChIKey | XSNZSKAAABDXFA-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(N1)[N+](=O)[O-])N2CCNCC2 |
Computed by PubChem (NCBI)