CAS 125546-04-5 appears in our catalog under these names: LY 233053, 97%, LY 233053, LY 233053. Offered by: Chemat Brand, GLPBio, Biosynth, MedChemExpress. Available pack sizes: on request, 1mg, 10mg, 50mg, 5mg, 25mg, Get quote.
(2R,4S)-4-(2H-tetrazol-5-ylmethyl)piperidine-2-carboxylic acid (CAS 125546-04-5) is a chemical compound with the molecular formula C8H13N5O2 and a molecular weight of 211.22 g/mol. IUPAC name: (2R,4S)-4-(2H-tetrazol-5-ylmethyl)piperidine-2-carboxylic acid. InChIKey: FAAVTENFCLADRE-NTSWFWBYSA-N.
| Molecular formula | C8H13N5O2 |
|---|---|
| Molecular weight | 211.22 g/mol |
| IUPAC name | (2R,4S)-4-(2H-tetrazol-5-ylmethyl)piperidine-2-carboxylic acid |
| InChIKey | FAAVTENFCLADRE-NTSWFWBYSA-N |
| SMILES | C1CN[C@H](C[C@H]1CC2=NNN=N2)C(=O)O |
Computed by PubChem (NCBI)