CAS 103392-51-4 appears in our catalog under these names: 1-O-Methyl Nataloe-Emodin, 1-o-Methylnataloe-emodin. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 5mg, 1mg, 10mg, 25mg, 50mg.
2,8-dihydroxy-1-methoxy-6-methylanthracene-9,10-dione (CAS 103392-51-4) is a chemical compound with the molecular formula C16H12O5 and a molecular weight of 284.26 g/mol. IUPAC name: 2,8-dihydroxy-1-methoxy-6-methylanthracene-9,10-dione. InChIKey: OCZOZMSHTPWVFR-UHFFFAOYSA-N.
| Molecular formula | C16H12O5 |
|---|---|
| Molecular weight | 284.26 g/mol |
| IUPAC name | 2,8-dihydroxy-1-methoxy-6-methylanthracene-9,10-dione |
| InChIKey | OCZOZMSHTPWVFR-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C1)O)C(=O)C3=C(C2=O)C=CC(=C3OC)O |
Computed by PubChem (NCBI)