Products 302551-56-0

CAS 302551-56-0 is the registry number for [(4-Methyl-6-oxo-6h-benzo[c]chromen-3-yl)oxy]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-(4-methyl-6-oxobenzo[c]chromen-3-yl)oxyacetic acid (CAS 302551-56-0) is a chemical compound with the molecular formula C16H12O5 and a molecular weight of 284.26 g/mol. IUPAC name: 2-(4-methyl-6-oxobenzo[c]chromen-3-yl)oxyacetic acid. InChIKey: WADNBVMGEJFFIZ-UHFFFAOYSA-N.

Identity
Molecular formulaC16H12O5
Molecular weight284.26 g/mol
IUPAC name2-(4-methyl-6-oxobenzo[c]chromen-3-yl)oxyacetic acid
InChIKeyWADNBVMGEJFFIZ-UHFFFAOYSA-N
SMILESCC1=C(C=CC2=C1OC(=O)C3=CC=CC=C23)OCC(=O)O

Computed by PubChem (NCBI)