Products 1034026-17-9
CAS 1034026-17-9 appears in our catalog under these names: 5-(Benzyloxy)-2-methylbenzoic acid, 95%, 5-(Benzyloxy)-2-methylbenzoic acid, ≥95%, ≥95%, 5-(Benzyloxy)-2-methylbenzoic acid. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
2-methyl-5-phenylmethoxybenzoic acid (CAS 1034026-17-9) is a chemical compound with the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. IUPAC name: 2-methyl-5-phenylmethoxybenzoic acid. InChIKey: YHBDGPJMDIUEEG-UHFFFAOYSA-N.
| Molecular formula | C15H14O3 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | 2-methyl-5-phenylmethoxybenzoic acid |
| InChIKey | YHBDGPJMDIUEEG-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)OCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)