CAS 1034047-06-7 appears in our catalog under these names: 6,11-Dihydro-2-(trifluoromethyl)-5H-pyrido[2,3-b][1,5]benzodiazepine, 97% , 6,11-Dihydro-2-(trifluoromethyl)-5H-pyrido[2,3-b][1,5]benzodiazepine, 97%. Offered by: Chemat Brand, Fluorochem. Available pack sizes: on request, 100mg.
2-(trifluoromethyl)-6,11-dihydro-5H-pyrido[3,2-c][1,5]benzodiazepine (CAS 1034047-06-7) is a chemical compound with the molecular formula C13H10F3N3 and a molecular weight of 265.23 g/mol. IUPAC name: 2-(trifluoromethyl)-6,11-dihydro-5H-pyrido[3,2-c][1,5]benzodiazepine. InChIKey: RDGYGVKEMDUPND-UHFFFAOYSA-N.
| Molecular formula | C13H10F3N3 |
|---|---|
| Molecular weight | 265.23 g/mol |
| IUPAC name | 2-(trifluoromethyl)-6,11-dihydro-5H-pyrido[3,2-c][1,5]benzodiazepine |
| InChIKey | RDGYGVKEMDUPND-UHFFFAOYSA-N |
| SMILES | C1C2=C(NC3=CC=CC=C3N1)N=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)